![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | A State of Fear_ New_book_exposes_UKs_unethical_psyops_team_that_ramps_up_anxiety_over_Covid-19_to_control_a_compliant_public RT Op-ed_May_20_2021.pdf | 2021-05-20 17:31 | 158K | |
| 'Burning Bodies In Secret' - New Accounts From Wuhan Detail Coronavirus Outbreak _ Zero Hedge.pdf | 2020-01-31 14:08 | 257K | |
| 5G network coming to Wuhan_article_Apr_2018.pdf | 2020-02-03 15:28 | 156K | |
![[IMG]](/icons/image2.gif) | 5472.jpg | 2020-01-31 18:11 | 57K | |
| A Federal Ban on Making Lethal Viruses Is Lifted - The New York Times (Dec 2017).pdf | 2020-02-04 13:45 | 80K | |
| A_Deceptive_Construction - Why_We_Must_Question_The_COVID-19_Mortality_Statistics _(Iain_Davis_March_28_2021_UK_Column).pdf | 2021-04-18 16:45 | 329K | |
| A_Defence_of_the_Great_Barrington_Declaration Lockdown_Sceptics_March_23_2021.pdf | 2021-03-23 08:10 | 251K | |
| A_Defence_of_the_Great_Barrington_Declaration_From_it's_Powerful_Critics Lockdown_Sceptics_March_22_2021.pdf | 2021-03-27 17:01 | 1.2M | |
| A_year_of_fear - Gary_Sidley_HART_Group - The_Critic - March_23_2021.pdf | 2021-03-31 20:48 | 190K | |
| Abir_Ballan_tweets_March_16_2021_(immunity).pdf | 2021-06-20 11:45 | 130K | |
| A closer look at U.S. deaths due to COVID-19 - The Johns Hopkins News-Letter.pdf | 2020-11-27 08:22 | 2.3M | |
| After the Lockdown_ A Global Coronavirus Vaccination Program... - Global Research by Prof Michel Chossudovsky Global Research, April 25, 2020.pdf | 2020-05-13 20:09 | 876K | |
| A global team of experts has found 10 FATAL FLAWS in the main test for Covid and is demanding its urgently axed. As they should RT Op-ed.pdf | 2020-12-07 23:09 | 159K | |
| Almost_90_percent_of_coronavirus_patients_on_ventilators_died_in_large_U.S_study - The_Washington_Post_April_22_2020.pdf | 2021-05-02 17:42 | 5.1M | |
| Amazon_Show_Utopia_ Plot_Featured_Fake_Virus_Global_Vaccine_Program_to_Sterilize_World_Population_(InfoWars_June_2021).pdf | 2021-06-24 18:02 | 167K | |
| America's Super-Rich See Their Wealth Rise by $282 Billion in Three Weeks of Pandemic - Alan Macleod - Mintpress News Apr 27 2020.pdf | 2020-05-01 01:49 | 1.4M | |
| Anna_Brees_Facebook_post_which_resulted_in_ban.jpg | 2021-04-06 13:57 | 232K | |
| Anthrax Vaccine -- posts by Meryl Nass, M.D._ Why are some of the US' top scientists making a specious argument about the natural origin of SARS-CoV-2_.pdf | 2020-05-24 16:07 | 618K | |
| BBC_Propaganda_North_Tees_&_Hartlepool_July_2021 Thread Reader App.pdf | 2021-07-22 13:18 | 1.8M | |
| BDS leaflet - corona_fs final 4.20.2020.pdf | 2020-05-24 19:04 | 4.8M | |
| BIRD_Ivermectin_Recommendation_rebuttal_March_28_2021_EBMC_Dr_Tess_Lawrie.pdf | 2021-04-22 14:17 | 458K | |
| Belarusian_President_Claims_IMF_&_World_Bank_Offered_him_a_Bribe_to_Impose_COVID_Restrictions_Armstrong_Economics.pdf | 2021-10-18 10:36 | 134K | |
| Bergamo_coffin_photo_exposed_as_fake.jpg | 2021-12-28 10:56 | 128K | |
| Biochemical_companies_receive_grant_to_develop_COVID-19_therapeutic Pennsylvania_Business_Report_Jan_2021.pdf | 2021-01-13 23:15 | 360K | |
| Biological Weapons_ A Useful and Timely Factual Overview - Global Research By Larry Romanoff Global Research, February 07, 2020.pdf | 2020-02-10 15:21 | 582K | |
| Blackpool_Teaching_Hospitals_NHS_Foundation_Trust_FOI_Feb_26_2021.jpg | 2021-12-28 16:50 | 46K | |
| Bob_Moran_letter_to_Daily_Telegraph_Oct_2021.jpg | 2021-10-13 13:31 | 273K | |
| Brian_Gerrish_testimony_to_Reiner_Fllmich_ Our_oppressors_are_very_frightened_people _UK_Column-June_2021.pdf | 2021-06-02 15:55 | 346K | |
| Britain's lockdown was futile, says Swedish epidemiologist (Telegraph May 2020).pdf | 2020-05-07 15:58 | 1.3M | |
| By_putting_Big_Pharma_patents_before_patients_doctors_will_further_erode_trust_in_experts_Jonathan_Cook_Feb_22_2021.pdf | 2021-02-23 16:04 | 1.0M | |
| CDC_admits_no_Record_of_naturally_immune_transmitting_COVID-19_ZeroHedge_2021-11-15.pdf | 2021-11-15 16:19 | 203K | |
| CIA-biovirus-2019_Feb_9_2020_(Author unknown).pdf | 2020-02-25 14:42 | 957K | |
| COVID-19 Digital Rights Tracker Samuel Woodhams_top10vpn_magazine Apr 09 2020.pdf | 2020-04-16 01:57 | 825K | |
| COVID-19 Researcher Killed in Murder-Suicide, Police Say It’s Not Related to Research (May 6th 2020).pdf | 2020-05-06 19:44 | 299K | |
| COVID-19 Weekly Bulletin HART_April_8th_2021.pdf | 2021-04-08 21:49 | 2.7M | |
| COVID-19 Weekly Bulletin HART_April_16th_2021.pdf | 2021-04-16 20:36 | 3.1M | |
| COVID-19 Weekly Bulletin HART_April_22nd_2021.pdf | 2021-04-26 17:37 | 159K | |
| COVID-19 Weekly Bulletin HART_April_29th_2021.pdf | 2021-05-01 19:29 | 267K | |
| COVID-19 Weekly Bulletin HART_March_24_2021.pdf | 2021-03-24 14:46 | 2.1M | |
| COVID-19 Weekly Bulletin HART_March_31st_2021.pdf | 2021-03-31 19:17 | 2.4M | |
| COVID-19 Weekly Bulletin - HART_May_6th_2021.pdf | 2021-05-07 07:57 | 1.0M | |
| COVID-19_AstraZeneca_Vaccine_Analysis_Print March 14 2021.pdf | 2021-03-31 15:16 | 379K | |
| COVID-19_ Fools_rush_in_where_angels_fear_to_tread_The_Covid_Physician_(TCP)_June_06_2021).pdf | 2021-06-08 14:35 | 1.5M | |
| COVID-19_Fraud_+_the_War_on_Humanity_Dr_Mark_Bailey_+_Dr_John_Bevan-Smith_2021-11-11.pdf | 2021-11-11 14:26 | 5.1M | |
| COVID-19_ Further Evidence that the Virus Originated in the US - Global Research - By Larry Romanoff Global Research, March 11, 2020.pdf | 2020-03-13 15:34 | 156K | |
| COVID-19_ Targeting Italy and South Korea_ _The Chain of Transmission of Infection_ - Centre for Research on Globalization - By Larry Romanoff Global Research, March 21, 2020.pdf | 2020-03-23 00:15 | 327K | |
| COVID-19_ The Spearpoint For Rolling Out a 'New Era' of High-Risk, Genetically Engineered Vaccines -- Health & Wellness -- Sott.net - May 07 2020.pdf | 2020-05-11 04:15 | 340K | |
| COVID-19_Weekly_Bulletin HART_Group_Mar_01_2021.pdf | 2021-03-05 20:30 | 1.6M | |
| COVID-19_ an_overview_of_the_evidence HART_March_18_2021.pdf | 2021-03-18 17:24 | 492K | |
| COVID-19_mRNA_Pfizer-_BioNTech_Vaccine_Analysis_Print to March 14 2021.pdf | 2021-03-31 15:16 | 183K | |
| COVID-19 pandemic_ Vulnerable population groups in the occupied Palestinian territory and the legal duty - Lawyers for Palestinian Human Rights_Mar_31_2020.pdf | 2020-04-28 01:37 | 115K | |
| COVID_censorship_at_ResearchGate - Things_scientists_cannot_say_Denis G. Rancourt PhD_Jun_5_2020.pdf | 2021-04-10 13:39 | 924K | |
| CRG_letter_to_Boris_Johnson_Feb_13_2021.jpg | 2021-02-14 12:36 | 98K | |
| Central China province launches commercial 5G applications - Xinhua _ English.news.cn.pdf | 2020-02-03 15:28 | 926K | |
| Charles_Eisenstein_June_2021_1.The_Death_of_the_Festival.pdf | 2021-08-02 16:33 | 210K | |
| Charles_Eisenstein_June_2021_2_Fascism_and_the_Antifestival.pdf | 2021-08-02 16:35 | 198K | |
| Charles_Eisenstein_June_2021_3_.Mob_Morality_and_the_Unvaxxed.pdf | 2021-08-02 16:32 | 1.2M | |
![[ ]](/icons/unknown.gif) | Chen_Qiush_Wuhan_is_short_of_test_kits_beds_the_outbreak_is_serious.docx | 2020-02-05 18:52 | 28K | |
| Chen_Qiush_Wuhan_is_short_of_test_kits_beds_the_outbreak_is_serious_Jan_30_2020.pdf | 2020-02-05 18:53 | 116K | |
| Children rarely transmit COVID-19, doctors write in new commentary_ Schools can reopen in fall, they say, if safety guidelines are observed and community transmission is low -- ScienceDaily - July 2020.pdf | 2020-08-05 19:17 | 88K | |
| China's Coronavirus_ A Shocking Update. Did The Virus Originate in the US_ - By Larry Romanoff Global Research, March 04, 2020.pdf | 2020-03-09 12:13 | 1.9M | |
| China_ Vaccine Law Passed _June_29_2019_Library_of_Congress_Global_Legal_Monitor (Aug_27_2019).pdf | 2020-02-13 14:45 | 136K | |
| China asked WHO to cover up coronavirus outbr... _ Taiwan News_May_9_2020.pdf | 2020-05-14 00:50 | 346K | |
| China delayed releasing coronavirus info, frustrating WHO (Associated Press Jun 02 2020).pdf | 2020-06-02 23:13 | 960K | |
| Citizen journalist detained over Wuhan reporting 'restrained and fed by tube' _ World news _ The Guardian.pdf | 2020-12-10 11:43 | 271K | |
| Code_Review_Second_Analysis_of_Ferguson_Model Lockdown_Sceptics_May_2020.pdf | 2021-02-27 17:24 | 334K | |
| Code_Review_of_Ferguson_Model Lockdown_Sceptics_May_12_2020.pdf | 2021-02-27 17:25 | 461K | |
| Corman_Drosten_Review_Report-Addendum_ Peer_reviewed_literature_+_preprints_covering_wet-lab_experiments_in-silico_analysis_of_the_Corman_Drosten_protocol_design.pdf | 2021-01-11 23:52 | 8.0M | |
| Corona Virus Fakery And The Link To 5G Testing Annie Logical Uncensored.pdf | 2020-02-28 14:49 | 5.3M | |
| Corona Virus To End May 29th, Says Indian Boy Abighya Anand _Who Correctly Predicted Its Start, 8 Months Ago (Mar 272020 feednews article).pdf | 2020-04-02 01:46 | 1.1M | |
| Corona_Virus_Fakery_And_The_Link_To_5G_Testing_Annie_Logical_(Uncensored)_Jan_2020.pdf | 2020-02-28 14:49 | 5.3M | |
| Coronavirus Australia_ Lesley Seebeck says she won't download COVIDSafe app (The Age - Australia - Apr 27 2020).pdf | 2020-04-28 01:47 | 576K | |
| Coronavirus Contains _HIV Insertions_, Stoking Fears Over Artificially Created Bioweapon _ Zero Hedge Feb 1st 2020.pdf | 2020-02-02 01:24 | 945K | |
| Coronavirus Gives a Dangerous Boost to DARPAs Darkest Agenda - The Last American Vagabond (Whitney Webb May 4 2020).pdf | 2020-05-05 00:08 | 6.7M | |
| Coronavirus_ You Have Given Your Freedom Away Don't Abandon Critical Thinking Too (Disillusioned Blogger Mar 26 2020).pdf | 2020-05-01 13:53 | 1.6M | |
| Coronavirus lockdown_ German lawyer detained for opposition (UK Column Apr 14 2020).pdf | 2020-04-16 02:08 | 135K | |
| Covid-19-tech-responses-opinion-30-April-2020.pdf | 2020-05-04 00:37 | 603K | |
| Covid-19_ Social_murder_they_wroteelected_unaccountable_and_unrepentant _ The_BMJ_Kamran_Abbasi_executive_editor_BMJ_Feb_04_2021.pdf | 2021-02-09 16:11 | 107K | |
| Covid-19_and_the_HIV_connection_revealed Dr_Eddy_Bettermann_MD_Jun_28_2020.pdf | 2021-02-14 19:54 | 497K | |
| Covid-19_ politicisation_corruption_and_suppression_of_science _ The_BMJ_Kamran_Abbasi_executive_editor_BMJ_Nov_13_2020.pdf | 2021-02-09 16:22 | 192K | |
| Covid-19_ the war against the elderly in uncaring _care_ homes - UK Column - by Patrick Corbett Saturday, 2nd May 2020.pdf | 2020-05-12 03:00 | 171K | |
| Covid-status_certificate_scheme_could_be_unlawful_discrimination_says_EHRC _ Coronavirus _ The Guardian_April_14_2021.pdf | 2021-04-16 20:36 | 421K | |
| Covid_19_politicisation_corruption_and_suppression_of_science_Kamran_Abbasi_(BMJ_Nov_13_2020)_bmj.m4425.full.pdf | 2020-11-14 14:38 | 175K | |
| Covid_and_the_death_of_the_scientific_method_by_John_A_Fairclough_July_07_2021 Lockdown Sceptics.pdf | 2021-07-08 14:23 | 209K | |
| Covid_and_the_lockdown_effect-a_look_at_the_evidence_April_15_2021_(Spectator)_Dr_Simon_Wood.pdf | 2021-04-14 19:46 | 1.1M | |
| Creator Of US BioWeapons Act Says Coronavirus Is Biological Warfare Weapon _ Zero Hedge_Feb 4 2020.pdf | 2020-02-04 15:42 | 248K | |
| Cui_Bono_ The_COVID-19_Conspiracy_ _Architects_for_Social_Housing_(ASH)_February_19_2021.pdf | 2021-04-02 18:08 | 968K | |
| Current_vaccine_not_suf??cient - more_is_needed_to_eradicate_the_virus_Monica_Camozzi_Feb_01_2021_affaritaliani.it.pdf | 2021-03-15 16:30 | 665K | |
| Daily_Telegraph_BBC_admit_misleading_child_ward_claim_March 2021.jpg | 2021-03-28 22:09 | 254K | |
| Daszak_Tweet_Nov_21_2019.jpg | 2021-07-19 14:08 | 65K | |
| Department Mourns the Passing of Dr. Bing Liu _ Computational & Systems Biology (May 6th 2020).pdf | 2020-05-06 19:46 | 803K | |
| Did China's Tencent Accidentally Leak The True Terrifying Coronavirus Statistics _ Zero Hedge_Feb 5th 2020.pdf | 2020-02-06 00:25 | 207K | |
| Doctors - Too _many_deaths_are_being_blamed_on_coronavirus._ _ RichieAllen_Feb_27_2021.pdf | 2021-02-28 13:04 | 268K | |
| Doctors Pen Open Letter To Fauci Regarding The Use Of Hydroxychloroquine for Treating COVID-19 _ Zero Hedge.pdf | 2020-08-26 11:24 | 349K | |
| Dr. Carrie Madej Covid Shots, DNA and Transhumanism Forbidden Knowledge TV.pdf | 2021-05-11 10:44 | 1.4M | |
| Dr Brownstein _ Coronavirus XIV_ The Good News is Still There But Not Reported By Mainstream Media-Apr 03 2020.pdf | 2020-04-05 02:31 | 182K | |
| Dr_Fareed_addresses_Italian_Senate_at_COVID_summit_Sep_16_2021.pdf | 2021-09-17 12:04 | 2.0M | |
| Dr_Simon_tweets_Mar_30_2021_on_euegenics_and_parallels_with_current_Covid_situation.pdf | 2021-04-21 19:49 | 1.1M | |
| EXPLOS~1.PDF | 2021-10-14 17:01 | 1.1M | |
| Education_Scotland_letter_to_children-May_2021.jpg | 2021-05-19 14:03 | 88K | |
| Email_from_experienced_NHS_doctor_and_Univ_Prof_sent_to_UK_Column_Jan_2021.PNG | 2021-02-05 00:03 | 435K | |
| Engineered_protein_crystals_make_cells_magnetic --ScienceDaily_September_2019.pdf | 2021-05-23 20:43 | 100K | |
| Evidence_of_COVID_Vaccine_Injury - MWM_March_2021_summary.pdf | 2021-03-13 16:42 | 37M | |
| Exposing_Britains_Nightingale_Hospital_Scandal _ Principia_Scientific_Intl_Jan_10_2021.pdf | 2021-04-14 19:00 | 1.5M | |
| FOI_060421_Response_Birmingham_Community_Healthcare_April_22_2021.pdf | 2021-07-02 11:02 | 163K | |
| Facebook Fact Checker Worked At Wuhan Biolab; Ruled Out Virus-Leak While Debunking_Articles.pdf | 2020-04-27 23:56 | 6.5M | |
| Final_Evidence_Covid-19_Is_A SimEx_Planned_Simulation_Exercise_by_WHO_and_World_Bank Silviu_Costinescu_Sep_9_2020.pdf | 2020-10-06 16:56 | 5.3M | |
| Flu_Misinformation_and_Coronavirus_Fears_ My_Letter_to_Dr. Sanjay_Gupta Childrens_Health_Defense_(Robert_F.Kennedy_Jr_April_2020).pdf | 2020-04-17 21:03 | 550K | |
| Frederick_Forsyth_letter_in_Daily_Telegraph_April_06_2021.jpg | 2021-04-06 13:55 | 175K | |
| Freedom_Day_or_a_temporary_reprieve HART_July_20_2021.pdf | 2021-07-12 16:45 | 212K | |
| From_T4_To_Covid1984 Ned_Pamphilon_March_24_2021.pdf | 2021-04-04 00:38 | 238K | |
| Functional Genomic and Computational Assessment of Threats (Fun GCAT).pdf | 2020-02-06 15:23 | 121K | |
| Fury_at_do_not_resuscitate_notices_given_to_Covid_patients_with_learning_disabilities _ World_news _ The_Guardian - Feb_13_2021.pdf | 2021-02-14 12:23 | 536K | |
| Gates_Globalist_Vax_Agenda_ Win-Win_for_Big_Pharma_and_Mandatory_Vaccine_Policy - 21st_Century_Wire_Robert_F-Kennedy_Jr_Nov_12_2020.pdf | 2020-12-04 02:04 | 1.2M | |
| German_ministry_hired_scientists_to_induce_corona_fear - emails_leaked_to_De_Welt_Feb_09_2021.pdf | 2021-02-09 23:25 | 86K | |
| German lawyers initiate class-action Coronavirus litigation -- Health & Wellness -- Sott.net.pdf | 2020-12-07 14:37 | 174K | |
| Google_confesses-propaganda_agenda_ bans_all_Ivermectin_and_hydroxychloroquine_information - The_COVID_Blog_April_26_2021.pdf | 2021-05-02 17:39 | 585K | |
| HART_Group_Times_Response_March_22_2021.pdf | 2021-03-23 00:09 | 36K | |
| Had_COVID_ Youll_probably_make_antibodies_for_a_lifetime_(Ewan_Callaway)_Nature_magazine_May_2021.pdf | 2021-07-29 16:19 | 401K | |
| Have_we_reached_peak_neoliberalism_in_the_UK_Covid-19_response_ - The_BMJ_Jan_27_2021.pdf | 2021-04-02 17:40 | 182K | |
| Health_Canada_issues_advisory_for_face-masks_containing_graphene_CTV_News_Apr_03_2021_Christy_Somos.pdf | 2021-04-22 15:18 | 270K | |
| Health_Ranger_posts_new_microscopy_photos_of_Covid_swabs_Covid_masks_and_mysterious_red_and_blue_fibers NaturalNews.com_Apr_26_2021.pdf | 2021-04-26 15:35 | 2.6M | |
| Hospitals_say_Feds_are_seizing_masks_and_other_coronavirus_supplies_without_a_word_(LA_Times_7_April_2020).pdf | 2020-04-09 16:35 | 66K | |
| How_science_has_been_corrupted_Matthew_B_Crawford_UnHerd_article_May_03_2021.pdf | 2021-05-06 16:53 | 441K | |
| How_to_improvise_a_coronavirus_face_mask.pdf | 2020-02-14 17:53 | 3.2M | |
| IATA_presentation_forecasts_Covid-19_download - March 5th 2020.pdf | 2020-03-10 16:47 | 616K | |
| ICU_vs_All_Cause_Death_Madrid-Catalua-20_Mar_2021_(Graph).pdf | 2021-04-12 23:42 | 120K | |
| I_Have_Been_Through_This_Before_Ann_Bauer_2021-10-27_(Tablet_Magazine).pdf | 2021-10-30 09:34 | 248K | |
| Immunity_after_SARS-CoV-2_infections_(Jagannathan_+_Wang)_Nature_Immunology_April_19_2021.pdf | 2021-05-02 19:56 | 937K | |
| Imperial_Folly_ Neil_Ferguson_Has_No_Qualification_in_Biological_Sciences - 21st_Century_Wire_Feb_25_2021.pdf | 2021-02-25 22:53 | 1.5M | |
| In 2018, Diplomats Warned of Risky Coronavirus Experiments in a Wuhan Lab. No One Listened. - POLITICO.pdf | 2021-05-04 19:55 | 1.2M | |
| Indian variant over-hyped HART.pdf | 2021-05-22 13:13 | 382K | |
| Inferring_UK_COVID-19_fatal_infection_trajectories_from_daily_mortality_data_were_infections_already_in_decline_before_the_UK_lockdowns_Simon_Wood_June_2021.pdf | 2021-10-13 14:27 | 1.7M | |
| International-Health-Professionals-Letter-multiple-signatories-Aug-26-2020.pdf | 2021-02-23 15:51 | 385K | |
| Ireland_Coroner_questions_Covid_death_rates_April 19 2021_newspaper_article.jpg | 2021-04-19 14:33 | 441K | |
| Is-this-leaked-info-really-Trudeaus-crazy-COVID-plan-for-2021-You-decide-...-The-Canadian_Report_LPC_October_2020_email.pdf | 2021-04-10 19:35 | 954K | |
| Is_the_MHRA_Yellow_Card_Reporting_System_Fit_For_Purpose__Lockdown_Sceptics_March_10_2021.pdf | 2021-03-11 15:49 | 522K | |
| Jacques_Attali_Verbatim_extract.jpeg | 2021-10-07 15:05 | 149K | |
| John Whitehead_ The Attack on Civil Liberties in the Age of COVID-19_Apr 02 2020 (Mintpress News).pdf | 2020-04-07 14:01 | 2.7M | |
| LANCET_Editorial_Clarifying_the_evidence_on_SARS-CoV-2_antigen_rapid_tests_in_public_health_responses_to_COVID-19_Feb_17_2021.pdf | 2021-02-19 19:36 | 654K | |
| LANCET_Editorial_Feb_19_2021_When_Should_the_UK_lift_its_Lockdown.pdf | 2021-02-28 20:20 | 134K | |
| Lab-Made_ SARS-CoV-2 Genealogy Through the Lens of Gain-of-Function Research.pdf | 2020-05-24 13:16 | 49M | |
| Lawyers_Promise_Nuremberg_Trials_Against_All_Behind_COVID_Scam _ Principia Scientific Intl_Jean-Michel_Grau_Feb_24_2021.pdf | 2021-03-04 22:32 | 801K | |
| Legal worries on EU's 'green certificates' for Covid travel.pdf | 2021-05-06 11:57 | 60K | |
| Letter_to_Times_about_GP_face-to-face_consultations.jpg | 2021-06-01 15:07 | 806K | |
| Local Biotech Company Developing Coronavirus Vaccine – NBC 7 San Diego.pdf | 2020-02-28 14:58 | 1.8M | |
| Lockdown_ A_police_constable_perspective_letter_sent_to_UK_Column_Jan_2021.pdf | 2021-01-14 19:10 | 130K | |
| Lockdowns_Need_to_Be_Intellectually_Discredited_Once_and_For_All_(Ethan_Yang_AIER_article)_May_2021.pdf | 2021-05-27 00:16 | 712K | |
| Lockdowns_have_killed_millions - Sebastian_Rushworth_M.D_March_01_2021.pdf | 2021-03-01 21:16 | 466K | |
| MERS_ A_Virologist's_View_From_Saudi_Arabia _ Science _ AAAS_Kai_Kupferschmidt_May_6_2014_interview_w_Christian_Drosten.pdf | 2021-03-21 00:39 | 763K | |
| MHRA_FOIA_April_2021.jpg | 2021-04-29 17:06 | 675K | |
| Mansoura_University_Ivermectin_based_Study_Results_in_Superior_Viral_Clearance_+_Peer_Review_Status_in_Journal_of_Medical_Virology_TrialSite_News_Feb_18_2021.pdf | 2021-02-22 21:15 | 513K | |
| Manufacturing_a_crisis_HART_article_June_2021.pdf | 2021-06-21 17:14 | 321K | |
| Masks_Dont_Work-A_review_of_science_relevant_to_COVID-19_social_policy_Denis_G_Rancourt_PhD_April_2020.pdf | 2021-04-10 13:13 | 317K | |
| Mass-Tracking COVI-PASS Immunity Passports Slated to Roll Out in 15 Countries (Raul Diego - Mintpress News - Jun 2020).pdf | 2020-11-29 14:24 | 1.5M | |
| Matt Hancock violates patient confidentiality HART May 20 2021.pdf | 2021-05-22 13:12 | 193K | |
| Members_of_the_European_Parliament_Served_with_Notices_of_Liability_for_COVID-19_Vaccine_Harms_and_Deaths_on_April_20_2021 _ by_Doctors_for_Covid_Ethics _ Medium.pdf | 2021-04-25 19:42 | 1.1M | |
| Midazolam_and_Mass_Murder_Letter_to_Sajid_Javid_2021_08_16.pdf | 2021-08-17 12:24 | 1.7M | |
| More_than_160,000_waiting_more_than_a_year_for_hospital_treatment Royal_College_of_Surgeons.pdf | 2021-04-14 19:44 | 96K | |
| Mortality_risk_from_COVID-19_22_April_2021 HART.pdf | 2021-04-26 17:31 | 648K | |
| Mutant_variations_and_the_danger_of_lockdowns - Jemma_Moran - The_Critic - Mar_02_2021.pdf | 2021-03-14 17:48 | 245K | |
| Mysterious Heart Damage, Not Just Lung Troubles, Befalling COVID-19 Patients _ Kaiser Health News.pdf | 2020-04-07 22:40 | 637K | |
| NHS_Somerset_Musgrove_Park_Park_Hospital_FOI_request_August_2021.jpg | 2021-09-16 10:15 | 84K | |
| NIH_email_citing_Jay_Bhattacharya_(unnamed_in_email)_2020-10-08.jpg | 2021-12-18 10:02 | 88K | |
| Nazi_Healthcare_Revived_Across_the_Five_Eyes - Killing_Useless_Eaters_and_Bidens_COVID_Relief_Bill_Matthew_Ehret_March_2021.pdf | 2021-03-27 17:18 | 1.7M | |
| Never Has So Little Done So Much Harm to So Many_NHF_speech_coronavirus.pdf | 2020-04-08 18:51 | 597K | |
| New_York_Times_Blasted_for_Citing_Unpublished_Research_Inciting_Fear_About_New_COVID_Variant Children's_Health_Defense_Feb_26_2021.pdf | 2021-03-01 11:53 | 318K | |
| No_the_Wuhan_Virus_Is_Not_a_Snake_Flu _ WIRED_(Jan_2020).pdf | 2020-01-31 17:15 | 11M | |
| Nobel_Prize_winner_who_discovered_HIV_says_coronavirus_was_definitely_released_from_Wuhan_lab_contains_HIV_DNA Dr_Eddy_Bettermann_MD_Oct_23_2019.pdf | 2021-02-14 19:55 | 1.6M | |
| Not_a_shred_of_doubt_Eyal_Shahar_June_2021.pdf | 2021-06-03 17:28 | 580K | |
| Notices_of_Liability_for_COVID-19_Vaccine_Harms_and_Deaths_Served_on_ All_Members_of_the_European_Parliament _ by_Doctors_for_Covid_Ethics _ Apr, 2021 _ Medium.pdf | 2021-04-25 19:41 | 123K | |
| OHCHR _ Bachelet calls for easing of sanctions to enable medical systems to fight COVID-19 and limit global contagion.pdf | 2020-04-28 01:39 | 142K | |
| Open Rights Group (ORG) Digital democracy & Covid-19 - April 2020.pdf | 2020-04-08 01:18 | 107K | |
| Operation_Coronavirus_is_Working_Hand_in_Hand_with_the_Nanotech_Agenda _ The_Wall_Will_Fall_Makia_Freeman_Oct_2020.pdf | 2021-01-23 11:49 | 225K | |
![[DIR]](/icons/folder.gif) | Other (includes speculative 5G, radiation etc conflations)/ | 2020-05-30 20:30 | - | |
| Our grave concerns about the handling of the COVID pandemic by Governments of the Nations of the UK Covid19 Assembly.pdf | 2021-08-23 10:17 | 1.8M | |
| POTUS-Memo-on-Wuhan-Plus-1.2 (Robert David Steele).pdf | 2020-03-11 16:15 | 835K | |
| Pandemic_preparedness_UK_government_kept_coronavirus_modelling_secret_Clare_Dyer_June_11_2021_(BMJ).pdf | 2021-06-16 17:25 | 152K | |
| Peer_Reviewed_ Randomized_Controlled_Trial_in_Nigeria_Shows_Ivermectin_Exhibits_Positive_Clinical_Benefit_in_Mild_to_Moderate_COVID-19_TrialSite_News-Feb_2021.pdf | 2021-02-19 23:28 | 1.5M | |
| Perma _PRC_Vaccine_Law 中华人民共和国疫苗管理法.pdf | 2020-02-13 14:47 | 133K | |
| Pompeo_Calls_on_Biden_to_Acknowledge_CCPs_Role_in_Pandemic_After_Memo_Release_Epoch_Times_Jan_27_2021.pdf | 2021-01-29 13:19 | 178K | |
| Probability_and_Risk_ The_curious_change_in_relationship_between_999_COVID_calls_and_COVID_deaths_Feb_03_2021.pdf | 2021-02-04 19:30 | 741K | |
| Quarter_of_Covid_deaths_not_caused_by_virus_figures_show_The_Telegraph_April_13_2021.pdf | 2021-04-14 19:43 | 293K | |
| Renee_Hoenderkamp_tweet_reminder_on_case_definition_April_05_2021.PNG | 2021-04-05 20:28 | 52K | |
| Report-on-Detention-and-COVID-Final-1_Richard_Coker_Prof_Mar_2020_compressed.pdf | 2020-03-27 23:27 | 202K | |
| Researchers at IBEC help identifying a drug in clinical phase that blocks the effects of SARS-Co-V2 - Institute for Bioengineering of Catalonia (IBEC).pdf | 2020-04-07 21:38 | 842K | |
| Retroviral Plague_ An interview with molecular biologist Judy Mikovits -- Health & Wellness -- Sott.net.pdf | 2020-05-11 04:12 | 263K | |
| Revealed_ Documents_Show_ Bill_Gates_Has_ Given_$319_Million_to_ Media_ Outlets_Alan_Macleod_MintPressNews_2021-11-15.pdf | 2021-11-22 14:03 | 2.5M | |
| Revealed_ Dominic Cummings on secret scientific advisory group for Covid-19 _ World news _ The Guardian.pdf | 2020-04-24 20:09 | 464K | |
| Revealed_ What_Really_Happened_In_The_Nightingale_hospitals _ Principia_Scientific_Intl_March_25_2021.pdf | 2021-04-14 18:59 | 1.2M | |
| Revealed_ the secret report that gave ministers warning of care home coronavirus crisis _ World news _ The Guardian.pdf | 2020-05-07 19:53 | 1.0M | |
| Review_of_the_Emerging_Evidence_Demonstrating_the_Efficacy_of_Ivermectin_in_the_Prophylaxis_and_Treatment_of_COVID-19_Kory_et_al_Dec_08_2020.pdf | 2020-12-10 15:13 | 2.1M | |
| Romanian_doctor_Flavia_Gro?an_says_she_cures_100_percent_of_COVID_patients _ Blogs _ Lifesitenews_Mar_24_2021.pdf | 2021-04-22 15:16 | 157K | |
| Sren_Ventegod_JIMT-Why_the_Corruption_of_the_World_Health_Organization_(WHO)_is_the_Biggest_Threat_to_the_Worlds_Public_Health_of_Our_Time_Jan_20150004.pdf | 2021-07-20 13:47 | 1.5M | |
| Sage_and_the_failure_of_Science_The_Conservative_Woman_George_Hooper_Feb_2021.pdf | 2021-02-11 23:38 | 3.0M | |
| Sage_and_the_failure_of_science _ The_Conservative_Woman_George_Cooper_Feb_09_2021.pdf | 2021-02-09 17:10 | 241K | |
| Secret planning exercise in 2016 modelled impact of Mers outbreak in UK _ Health _ The Guardian.pdf | 2021-06-14 17:03 | 371K | |
| Should_primary_schoolchildren_be_made_to_wear_masks_ _ Education _ The_Guardian_Natalie_Grover_Mar_02_2021.pdf | 2021-03-04 11:47 | 130K | |
| Simon_Wood_staistician_on_data_interpretation_around_COVID-19_figures_April_2021_(blogpost).pdf | 2021-04-05 21:10 | 606K | |
| Situation_Still_Normal _ Bad_Medicine_by_Dr_No_Dec_31_2020.pdf | 2020-12-31 18:56 | 650K | |
| Solitary_Report_2020_FINAL_021220 - Isolated_&_Alone-Defense_for_Children_International.pdf | 2020-12-04 01:07 | 5.7M | |
| Staphylococcal_Enterotoxin_B_(SEB)_a_bioweapon_@Kevin_McKernan_on_Thread_Reader_App_December_2021.pdf | 2021-12-11 12:54 | 1.3M | |
| Study_ Smokers Appear Less Likely to Be Hospitalised with COVID-19 (Breitbart).pdf | 2020-04-10 00:58 | 477K | |
| Sudden Militarization Of Wuhan's P4 Lab Raises New Questions About The Origin Of The Deadly Covid-19 Virus _ Zero Hedge.pdf | 2020-02-13 14:56 | 681K | |
| Sunetra_Gupta_Colleagues_Come_to_Her_Defence_After_Rude_Dismissive_BBC_Interview Lockdown Sceptics_Toby_Young_May_3_2021.pdf | 2021-05-03 14:56 | 1.7M | |
| The Coronavirus and the New World Order. _War is in the Air_ - Global ResearchGlobal Research - Centre for Research on Globalization.pdf | 2020-03-21 23:25 | 456K | |
| The_Covid_Cult_Attack_on_Science_and_Society_Brownstone_Institute_Roger_Koops_Aug_30_2021.pdf | 2021-08-31 15:12 | 700K | |
| The_Covid_Physicians_true_coronavirus_timeline_November_2020.pdf | 2021-06-30 15:50 | 543K | |
| The_Failure_of_Imperial_College_Modeling_Is_Far_Worse_than_We_Knew_Phillip_W._Magness_AIER_article_April_22_2021.pdf | 2021-04-22 17:55 | 390K | |
| The_Frightened_Class_Thomas_Harrington_(Brownstone_Institute_article)_October_19_2021.pdf | 2021-10-20 14:07 | 174K | |
| The_Great_Canadian_Timeline_to_Tyranny.jpg | 2021-04-10 18:22 | 85K | |
| The_Israeli_People_Committee_April_Report_on_the_lethal_impact_of_vaccinations Gilad_Atzmon_April_21_2021.pdf | 2021-04-24 21:47 | 304K | |
| The_New_Nuremberg_Trials_2021 BreakingNewsCA_May_07_2021.pdf | 2021-05-07 15:15 | 3.1M | |
| The_Spectre_of_Eugenics_in_the_Age_of_Covid - The_Highwire_Jefferey_Jaxen_March_2021.pdf | 2021-03-14 23:07 | 108K | |
| The_UK_Plot_to_Silence_Lockdown_Critics_Jayanta_Bhattacharya_August_2021.pdf | 2021-08-03 15:16 | 456K | |
| The_Web_of_Elite_Extremists_Behind_Censorship_of_Mercola_March_2021.pdf | 2021-03-07 18:40 | 429K | |
| The_coronavirus_may_sometimes_slip_its_genetic_material_into_human_chromosomesbut_what_does_that_mean_ _ Science _ AAAS.pdf | 2021-02-27 16:29 | 648K | |
| The_manufacturing_of_fear - spiked_Laura_Dodsworth_May_28_2021.pdf | 2021-05-28 17:20 | 1.1M | |
| The_myth_of_our_late_lockdown_spiked_David_Paton_March-18_2021.pdf | 2021-10-12 16:06 | 341K | |
| There_Is_No_Pandemic _Iain_Davis_for_UKColumn_2021-09-30.pdf | 2021-09-30 16:44 | 768K | |
| They_Thought_They_Were_Free_The_Germans_1933-45_Milton_Mayer_an_excerpt_2017_edition.pdf | 2021-07-28 14:23 | 284K | |
| Tim Montalk premonition Covid_Pastebin.com - Printed Paste ID_ https___pastebin.com_March_2020.pdf | 2021-04-19 00:31 | 81K | |
| Truth_Will_Prevail-1200_studies_that_refute_vaccine_claims_(Dr._Alan_Palmer).pdf | 2021-05-02 13:58 | 11M | |
| Twitter_Censors_Famed_Epidemiologist_Martin_Kulldorff_Jeffrey_A_Tucker_March_29_2021_AIER_article.pdf | 2021-03-31 19:37 | 636K | |
| Twitter_conversation_Fraser_Nelson_w_Graham_Medley_chairman_of_SAGE_Covid_modelling_committee _The Spectator_2021-12-18.pdf | 2021-12-19 11:30 | 6.3M | |
| Two_Different_Antibody-Dependent_Enhancement_(ADE)_Risks_for_SARS-CoV-2_Antibodies_Darrell O. Ricke_Fronyiers_in_Immunology_Feb_2021.pdf | 2021-05-25 13:51 | 1.5M | |
| UK test and trace service did not complete mandatory privacy checks POLITICO.pdf | 2020-07-10 12:07 | 206K | |
| UK 'Coronaphobia' is Pushing the Country Towards a Stasi-like State - 21st Century Wire.pdf | 2020-09-15 14:37 | 1.8M | |
| UK Government Response to Covid-19_Digital_Contact_Tracing_and_the_right_to_privacy.pdf | 2020-05-07 17:10 | 245K | |
| UK_Govt_Scientist_Exposes_COVID-19_Hospital_Beds_Scam _ Principia_Scientific_Intl_Oct_03_2020.pdf | 2021-04-14 19:03 | 3.3M | |
| UK government 'using pandemic to transfer NHS duties to private sector' _ Business _May_4th_2020- The Guardian.pdf | 2020-05-06 14:28 | 448K | |
| UK government using confidential patient data in coronavirus response _ World news _ The Guardian.pdf | 2020-04-24 20:09 | 781K | |
| Unexpected_detection_of_SARS-CoV-2_antibodies_in_the_prepandemic_period_in_Italy_(Apalone_et_al)_Oct_29_2020_pub.SAGE.pdf | 2020-11-23 17:45 | 1.4M | |
| Unregulated_Investment_Firm_BlackRock_ More_Political_and_Financial_Influence_than_the_Federal_Reserve_and_Most_Governments_(Vaccine_Impact).pdf | 2021-06-30 17:39 | 2.2M | |
| Use_of_digital_technologies_to_tackle_pandemics - POST_April_29_2021.pdf | 2021-05-10 17:30 | 487K | |
| Virus Is Found in Many With Chronic Fatigue Syndrome -- Health & Wellness -- Sott.net.pdf | 2020-05-11 04:11 | 123K | |
| Vitamin D deficiency linked to COVID-19 deaths -- Health & Wellness -- Sott.net.pdf | 2020-05-11 04:14 | 140K | |
| WHO-2019-nCov-IPC_Masks-2020.4-eng_Advice_on_the_use_of_masks_in_the_context_of_COVID-19_Interim_Guidance_document_Jun_05_2020.pdf | 2021-04-02 17:03 | 519K | |
| WHO_(finally)_admits_PCR_tests_create_false_positives OffGuardian_Dec_2020.pdf | 2021-05-09 11:55 | 2.1M | |
| WHO_Deletes_Naturally_Acquired_Immunity_from_Its_Website_(Jeffrey_Tucker_AIER_article)_Dec_2020.pdf | 2021-05-30 16:45 | 522K | |
| WHO_Guidelines_Cause_of_Death_COVID-19_Spring_2020-International_Guidelines_for_Certification_and_Classification_(Coding)_of_COVID-19_as_Cause_of_Death_April_16_2020.pdf | 2021-04-02 17:02 | 734K | |
| WHO_Insider_Blows_Whistle_on_Gates_and_GAVI_(Astrid_Stuckelberger)_March_2021_(Mercola).pdf | 2021-04-07 17:41 | 271K | |
| WHO_changes_definition_of_herd_immunity_Kit_Knightly_OffGuardian.pdf | 2021-02-07 21:05 | 644K | |
| WHO_redefines_herd_immunity_between_Jun_2020_+_November_2020.jpg | 2020-12-27 12:05 | 119K | |
| WHO_tweet_Jan_14_2020_claiming_no_human_to_human_transmission_of_COVID-19.PNG | 2020-05-24 21:22 | 102K | |
| WHO_wanted_pandemic_lockdowns_Jeffrey_A_Tucker_AIER_article_Feb_09_2021.pdf | 2021-02-12 17:58 | 297K | |
| WHO inspector has conflict of interest in Wuhan COVID probe_ Prominent biologist _ Taiwan News _ 2021_02_04.pdf | 2021-03-12 07:37 | 481K | |
| WUHAN AND HARVARD... AND JEFFREY - Joseph P. Farrell.pdf | 2020-02-06 15:25 | 316K | |
| We_are_all_Pavlov's_dogs_now _ UK_Column_May_02_2021_(Dr_Bruce_Scott).pdf | 2021-05-03 23:00 | 508K | |
| We_are _not_going_back_to_normal - MIT Technology Review (Gideon Lichfield).pdf | 2020-03-25 10:20 | 315K | |
| We don't know why so few covid-19 cases have been reported in Africa _ New Scientist.pdf | 2020-03-11 17:08 | 1.3M | |
| When_Did_the_Coronavirus_Get_to_the_US_ _ The_Peoples_ Pharmacy_Terry_Graedon.pdf | 2021-01-03 01:19 | 408K | |
| Where is Timothy Cunningham's Whistleblower Report on Coronavirus_ -.pdf | 2020-04-02 02:57 | 1.4M | |
| Whistleblower_Nurse_Exposes_Empty_UK_Hospital_Fake_Pandemic _ Principia_Scientific_Intl_Aug_24_2020.pdf | 2021-04-14 18:58 | 401K | |
| Why_Is_Everyone_in_Texas_Not_Dying_Jeffrey_A_Tucker_AIER_article_March_26_2021.pdf | 2021-03-29 01:59 | 614K | |
| Why_have_we_ doctors_been_ silent_Susie_Wilk_( The_Conservative_ Woman)_2021-11-15.pdf | 2021-11-15 15:09 | 145K | |
| Why_no_one_can_ever_recover_from_COVID-19_in_England a_statistical_anomaly - The_Centre_for_Evidence_Based_Medicine_Yoon_K_Loke_and_Carl_Heneghan_July_16_2020.pdf | 2021-04-02 17:06 | 1.1M | |
| Why_politicians_and_doctors_keep_ignoring_the_medical_research_on_Vitamin_D_and_Covid_Jonathan_Cook_Feb_15_2021.pdf | 2021-02-15 13:50 | 637K | |
| William_Wragg_MP_letter_to_Michael_Gove_March_19_2021_PACAC_Cttee.pdf | 2021-03-20 17:35 | 474K | |
| Wuhan Virus Research Institute is fully committed to scientific research on new coronavirus pneumonia (Shi Zenghli).pdf | 2020-06-02 23:16 | 636K | |
| Yes, hydroxychloroquine is scientifically proven against COVID-19 - Filipes Newsletter - Part I.pdf | 2020-12-15 11:02 | 1.4M | |
| Yes, hydroxychloroquine is scientifically proven against COVID-19 - PART II - Filipes Newsletter.pdf | 2020-12-15 11:05 | 1.8M | |
| You_are_no_safer_from_COVID_social_distancing_at_6_or_60_feet_study_NY_Post_Apr_26_2021.pdf | 2021-04-26 23:15 | 2.0M | |
| Yuval_Noah_Harari_ the_world_after_coronavirus _Financial_Times_Nov_2020.pdf | 2020-11-25 18:59 | 2.3M | |
| [LETTER]_BMJ_Positive_results_from_UK_single_gene_PCR_testing_for_SARS-COV-2_may_be_inconclusive_negative_or_detecting_past_infections_March_11_2021_Prof.Martin_Neil.pdf | 2021-03-23 14:22 | 109K | |
| [LETTER]_Our_grave_concerns_about_the_handling_of_the_COVID_pandemic_by_Governments_of_the_Nations_of_the_UK_Covid19_Assembly.pdf | 2021-08-23 10:17 | 1.8M | |
| [LETTER]_The_performance_of_the_SARS-CoV-2_RT-PCR_test_as_a_tool_for_detecting_SARS-CoV-2_infection_in_the_population_(Stang_et_al)_June_2021.pdf | 2021-06-18 16:22 | 389K | |
| [Letter]_Covid-19_does_not_lead_to_a_typical_ARDS_ATS_American_Thoracic_Society_journal_(Luciano_ Gattinoni_et_al_Mar_30_2020)_rccm.202003-0817le.pdf | 2020-04-07 22:55 | 169K | |
| drsircus.com-Viruses are pH Sensitive.pdf | 2020-03-06 15:02 | 211K | |
| kwUDnVNd_200130_Alex_Jones_show_transcript.pdf | 2020-02-03 15:05 | 45K | |
![[TXT]](/icons/text.gif) | kwUDnVNd_200130_Alex_Jones_show_transcript.txt | 2020-02-03 15:00 | 6.1K | |
|
|---|
_2020-10-08.jpg){kind=link}
